C24H40N4O3 — CID 86964366
4-(2-methoxyethoxy)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]piperidine-1-carboxamide (PubChem CID 86964366) has the molecular formula C24H40N4O3 and a molecular weight of 432.61 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]piperidine-1-carboxamide.
| Compound Name | 4-(2-methoxyethoxy)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86964366 |
| Molecular Formula | C24H40N4O3 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]piperidine-1-carboxamide |
| SMILES | COCCOC1CCN(C(=O)NC(C)CCN2CCN(c3cccc(C)c3)CC2)CC1 |
| InChI | InChI=1S/C24H40N4O3/c1-20-5-4-6-22(19-20)27-15-13-26(14-16-27)10-7-21(2)25-24(29)28-11-8-23(9-12-28)31-18-17-30-3/h4-6,19,21,23H,7-18H2,1-3H3,(H,25,29) |
| InChIKey | NKMBALFDEPXRFW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|