C25H31BrN2O2 — CID 55763251
1-(4-bromobenzoyl)-N-(2-ethyl-1-phenylbutyl)piperidine-4-carboxamide (PubChem CID 55763251) has the molecular formula C25H31BrN2O2 and a molecular weight of 471.44 g/mol. Its IUPAC name is 1-(4-bromobenzoyl)-N-(2-ethyl-1-phenylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-bromobenzoyl)-N-(2-ethyl-1-phenylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55763251 |
| Molecular Formula | C25H31BrN2O2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 1-(4-bromobenzoyl)-N-(2-ethyl-1-phenylbutyl)piperidine-4-carboxamide |
| SMILES | CCC(CC)C(NC(=O)C1CCN(C(=O)c2ccc(Br)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H31BrN2O2/c1-3-18(4-2)23(19-8-6-5-7-9-19)27-24(29)20-14-16-28(17-15-20)25(30)21-10-12-22(26)13-11-21/h5-13,18,20,23H,3-4,14-17H2,1-2H3,(H,27,29) |
| InChIKey | HBKZTTQONBHECS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |