C24H24ClN3O2 — CID 55763588
N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-oxo-6-phenyl-1H-pyridine-3-carboxamide (PubChem CID 55763588) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-oxo-6-phenyl-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55763588 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCC(c1cccc(Cl)c1)N1CCCC1)c1ccc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C24H24ClN3O2/c25-19-10-6-9-18(15-19)22(28-13-4-5-14-28)16-26-23(29)20-11-12-21(27-24(20)30)17-7-2-1-3-8-17/h1-3,6-12,15,22H,4-5,13-14,16H2,(H,26,29)(H,27,30) |
| InChIKey | JSSCKTKFLZCQHK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |