C25H36N4O4S — CID 55763957
5-methyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide (PubChem CID 55763957) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is 5-methyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide.
| Compound Name | 5-methyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55763957 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 5-methyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-4-pyrrolidin-1-ylsulfonylfuran-2-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)c3cc(S(=O)(=O)N4CCCC4)c(C)o3)CC2)c1 |
| InChI | InChI=1S/C25H36N4O4S/c1-20-8-7-9-22(18-20)28-16-14-27(15-17-28)11-4-3-10-26-25(30)23-19-24(21(2)33-23)34(31,32)29-12-5-6-13-29/h7-9,18-19H,3-6,10-17H2,1-2H3,(H,26,30) |
| InChIKey | UIMNYWKWEJUKOI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|