C24H27N3O4S2 — CID 55764371
N-methyl-N-[4-[2-oxo-2-(2-pyridin-4-ylazepan-1-yl)ethoxy]phenyl]thiophene-2-sulfonamide (PubChem CID 55764371) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-methyl-N-[4-[2-oxo-2-(2-pyridin-4-ylazepan-1-yl)ethoxy]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-methyl-N-[4-[2-oxo-2-(2-pyridin-4-ylazepan-1-yl)ethoxy]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55764371 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-methyl-N-[4-[2-oxo-2-(2-pyridin-4-ylazepan-1-yl)ethoxy]phenyl]thiophene-2-sulfonamide |
| SMILES | CN(c1ccc(OCC(=O)N2CCCCCC2c2ccncc2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-26(33(29,30)24-7-5-17-32-24)20-8-10-21(11-9-20)31-18-23(28)27-16-4-2-3-6-22(27)19-12-14-25-15-13-19/h5,7-15,17,22H,2-4,6,16,18H2,1H3 |
| InChIKey | SSGHYHHQXYETGG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |