C17H20N2O5S2 — CID 2380780
N-methyl-N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]thiophene-2-sulfonamide (PubChem CID 2380780) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-methyl-N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-methyl-N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2380780 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-methyl-N-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]thiophene-2-sulfonamide |
| SMILES | CN(c1ccc(OCC(=O)N2CCOCC2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-18(26(21,22)17-3-2-12-25-17)14-4-6-15(7-5-14)24-13-16(20)19-8-10-23-11-9-19/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | XFHIJJUOCYIYBN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |