C23H26N2O2 — CID 55765922
N-(3,3-dimethyl-1-phenylbutyl)-1-methyl-2-oxoquinoline-4-carboxamide (PubChem CID 55765922) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-phenylbutyl)-1-methyl-2-oxoquinoline-4-carboxamide.
| Compound Name | N-(3,3-dimethyl-1-phenylbutyl)-1-methyl-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55765922 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-(3,3-dimethyl-1-phenylbutyl)-1-methyl-2-oxoquinoline-4-carboxamide |
| SMILES | Cn1c(=O)cc(C(=O)NC(CC(C)(C)C)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H26N2O2/c1-23(2,3)15-19(16-10-6-5-7-11-16)24-22(27)18-14-21(26)25(4)20-13-9-8-12-17(18)20/h5-14,19H,15H2,1-4H3,(H,24,27) |
| InChIKey | MRKQGQHSXBMTAC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |