C15H12BrCl2FN2O2S — CID 55766385
5-bromo-2-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpyridine-3-sulfonamide (PubChem CID 55766385) has the molecular formula C15H12BrCl2FN2O2S and a molecular weight of 454.15 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55766385 |
| Molecular Formula | C15H12BrCl2FN2O2S |
| Molecular Weight | 454.15 g/mol |
| Exact Mass | 451.92 |
| IUPAC Name | 5-bromo-2-chloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpyridine-3-sulfonamide |
| SMILES | O=S(=O)(c1cc(Br)cnc1Cl)N(Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C15H12BrCl2FN2O2S/c16-9-6-14(15(18)20-7-9)24(22,23)21(10-4-5-10)8-11-12(17)2-1-3-13(11)19/h1-3,6-7,10H,4-5,8H2 |
| InChIKey | UYHJCERJTBVRRU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.15 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|