C17H16BrClFNO2 — CID 55770838
N-[(2-bromophenyl)methyl]-3-(2-chloro-4-fluorophenoxy)-N-methylpropanamide (PubChem CID 55770838) has the molecular formula C17H16BrClFNO2 and a molecular weight of 400.68 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-3-(2-chloro-4-fluorophenoxy)-N-methylpropanamide.
| Compound Name | N-[(2-bromophenyl)methyl]-3-(2-chloro-4-fluorophenoxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 55770838 |
| Molecular Formula | C17H16BrClFNO2 |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-3-(2-chloro-4-fluorophenoxy)-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CCOc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H16BrClFNO2/c1-21(11-12-4-2-3-5-14(12)18)17(22)8-9-23-16-7-6-13(20)10-15(16)19/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | OEYIMFWQNOKAEL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |