C16H21NO — CID 557722
5-(2-methylprop-1-enyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 557722) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 5-(2-methylprop-1-enyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(2-methylprop-1-enyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 557722 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 5-(2-methylprop-1-enyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | CC(C)=CC1CC(c2c(C)cc(C)cc2C)=NO1 |
| InChI | InChI=1S/C16H21NO/c1-10(2)6-14-9-15(17-18-14)16-12(4)7-11(3)8-13(16)5/h6-8,14H,9H2,1-5H3 |
| InChIKey | GJLCYZXRLLBQRP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|