C21H24F3NO — CID 123417645
3-[4-pent-1-ynyl-2-(trifluoromethyl)phenyl]-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole (PubChem CID 123417645) has the molecular formula C21H24F3NO and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[4-pent-1-ynyl-2-(trifluoromethyl)phenyl]-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole.
| Compound Name | 3-[4-pent-1-ynyl-2-(trifluoromethyl)phenyl]-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole |
|---|---|
| PubChem CID | 123417645 |
| Molecular Formula | C21H24F3NO |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-[4-pent-1-ynyl-2-(trifluoromethyl)phenyl]-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d][1,2]oxazole |
| SMILES | CCCC#Cc1ccc(C2=NOC3CCCCCCC23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H24F3NO/c1-2-3-6-9-15-12-13-16(18(14-15)21(22,23)24)20-17-10-7-4-5-8-11-19(17)26-25-20/h12-14,17,19H,2-5,7-8,10-11H2,1H3 |
| InChIKey | UKUXWXDXDBOXJT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|