C21H16ClN3O4 — CID 55772245
(5Z)-5-[[4-(2-chlorophenoxy)-3-nitrophenyl]methylidene]-1-methyl-6,7-dihydroindazol-4-one (PubChem CID 55772245) has the molecular formula C21H16ClN3O4 and a molecular weight of 409.83 g/mol. Its IUPAC name is (5Z)-5-[[4-(2-chlorophenoxy)-3-nitrophenyl]methylidene]-1-methyl-6,7-dihydroindazol-4-one.
| Compound Name | (5Z)-5-[[4-(2-chlorophenoxy)-3-nitrophenyl]methylidene]-1-methyl-6,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 55772245 |
| Molecular Formula | C21H16ClN3O4 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (5Z)-5-[[4-(2-chlorophenoxy)-3-nitrophenyl]methylidene]-1-methyl-6,7-dihydroindazol-4-one |
| SMILES | Cn1ncc2c1CC/C(=C/c1ccc(Oc3ccccc3Cl)c([N+](=O)[O-])c1)C2=O |
| InChI | InChI=1S/C21H16ClN3O4/c1-24-17-8-7-14(21(26)15(17)12-23-24)10-13-6-9-20(18(11-13)25(27)28)29-19-5-3-2-4-16(19)22/h2-6,9-12H,7-8H2,1H3/b14-10- |
| InChIKey | CHELHCABAIHSTC-UVTDQMKNSA-N |
| XLogP | 4.99 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|