C17H18N2O2S — CID 51098986
(5E)-5-[(3-methoxy-4-methylsulfanylphenyl)methylidene]-1-methyl-6,7-dihydroindazol-4-one (PubChem CID 51098986) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is (5E)-5-[(3-methoxy-4-methylsulfanylphenyl)methylidene]-1-methyl-6,7-dihydroindazol-4-one.
| Compound Name | (5E)-5-[(3-methoxy-4-methylsulfanylphenyl)methylidene]-1-methyl-6,7-dihydroindazol-4-one |
|---|---|
| PubChem CID | 51098986 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (5E)-5-[(3-methoxy-4-methylsulfanylphenyl)methylidene]-1-methyl-6,7-dihydroindazol-4-one |
| SMILES | COc1cc(/C=C2\CCc3c(cnn3C)C2=O)ccc1SC |
| InChI | InChI=1S/C17H18N2O2S/c1-19-14-6-5-12(17(20)13(14)10-18-19)8-11-4-7-16(22-3)15(9-11)21-2/h4,7-10H,5-6H2,1-3H3/b12-8+ |
| InChIKey | UNWBQHYGUXENQY-XYOKQWHBSA-N |
| XLogP | 3.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|