C18H19N3OS2 — CID 55773686
N-methyl-3-(2-methylsulfanylimidazol-1-yl)-N-[(3-methylthiophen-2-yl)methyl]benzamide (PubChem CID 55773686) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-methyl-3-(2-methylsulfanylimidazol-1-yl)-N-[(3-methylthiophen-2-yl)methyl]benzamide.
| Compound Name | N-methyl-3-(2-methylsulfanylimidazol-1-yl)-N-[(3-methylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55773686 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-methyl-3-(2-methylsulfanylimidazol-1-yl)-N-[(3-methylthiophen-2-yl)methyl]benzamide |
| SMILES | CSc1nccn1-c1cccc(C(=O)N(C)Cc2sccc2C)c1 |
| InChI | InChI=1S/C18H19N3OS2/c1-13-7-10-24-16(13)12-20(2)17(22)14-5-4-6-15(11-14)21-9-8-19-18(21)23-3/h4-11H,12H2,1-3H3 |
| InChIKey | OZRLRMROJWXXMD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |