C19H17BrFN3OS — CID 55774651
N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-(2-methylsulfanylimidazol-1-yl)benzamide (PubChem CID 55774651) has the molecular formula C19H17BrFN3OS and a molecular weight of 434.33 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-(2-methylsulfanylimidazol-1-yl)benzamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-(2-methylsulfanylimidazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55774651 |
| Molecular Formula | C19H17BrFN3OS |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-methyl-3-(2-methylsulfanylimidazol-1-yl)benzamide |
| SMILES | CSc1nccn1-c1cccc(C(=O)N(C)Cc2cc(Br)ccc2F)c1 |
| InChI | InChI=1S/C19H17BrFN3OS/c1-23(12-14-10-15(20)6-7-17(14)21)18(25)13-4-3-5-16(11-13)24-9-8-22-19(24)26-2/h3-11H,12H2,1-2H3 |
| InChIKey | ZJJSCXCPAHWVBM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |