C24H29NO5 — CID 55774982
methyl 2-[2-methoxy-4-[methyl-(4-phenylcyclohexyl)carbamoyl]phenoxy]acetate (PubChem CID 55774982) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[methyl-(4-phenylcyclohexyl)carbamoyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-methoxy-4-[methyl-(4-phenylcyclohexyl)carbamoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 55774982 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | methyl 2-[2-methoxy-4-[methyl-(4-phenylcyclohexyl)carbamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)N(C)C2CCC(c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C24H29NO5/c1-25(20-12-9-18(10-13-20)17-7-5-4-6-8-17)24(27)19-11-14-21(22(15-19)28-2)30-16-23(26)29-3/h4-8,11,14-15,18,20H,9-10,12-13,16H2,1-3H3 |
| InChIKey | DICIXEJJXLFMJA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |