C18H20BrClN2O3 — CID 55776048
(5-bromo-3-methylfuran-2-yl)-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]methanone (PubChem CID 55776048) has the molecular formula C18H20BrClN2O3 and a molecular weight of 427.73 g/mol. Its IUPAC name is (5-bromo-3-methylfuran-2-yl)-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]methanone.
| Compound Name | (5-bromo-3-methylfuran-2-yl)-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55776048 |
| Molecular Formula | C18H20BrClN2O3 |
| Molecular Weight | 427.73 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | (5-bromo-3-methylfuran-2-yl)-[4-[2-(2-chlorophenoxy)ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1cc(Br)oc1C(=O)N1CCN(CCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H20BrClN2O3/c1-13-12-16(19)25-17(13)18(23)22-8-6-21(7-9-22)10-11-24-15-5-3-2-4-14(15)20/h2-5,12H,6-11H2,1H3 |
| InChIKey | DFNRMDAOQLWNNN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |