C25H24BrNO4 — CID 55776250
methyl 1-[2-(6-bromonaphthalen-2-yl)oxyacetyl]-4-phenylpiperidine-4-carboxylate (PubChem CID 55776250) has the molecular formula C25H24BrNO4 and a molecular weight of 482.37 g/mol. Its IUPAC name is methyl 1-[2-(6-bromonaphthalen-2-yl)oxyacetyl]-4-phenylpiperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(6-bromonaphthalen-2-yl)oxyacetyl]-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55776250 |
| Molecular Formula | C25H24BrNO4 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | methyl 1-[2-(6-bromonaphthalen-2-yl)oxyacetyl]-4-phenylpiperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)CCN(C(=O)COc2ccc3cc(Br)ccc3c2)CC1 |
| InChI | InChI=1S/C25H24BrNO4/c1-30-24(29)25(20-5-3-2-4-6-20)11-13-27(14-12-25)23(28)17-31-22-10-8-18-15-21(26)9-7-19(18)16-22/h2-10,15-16H,11-14,17H2,1H3 |
| InChIKey | ZDUJDGKMYPHCKX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |