C20H27N3O3 — CID 55776660
N-cyclopropyl-4-[(E)-3-(1-morpholin-4-ylpropan-2-ylamino)-3-oxoprop-1-enyl]benzamide (PubChem CID 55776660) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-(1-morpholin-4-ylpropan-2-ylamino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-(1-morpholin-4-ylpropan-2-ylamino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55776660 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-(1-morpholin-4-ylpropan-2-ylamino)-3-oxoprop-1-enyl]benzamide |
| SMILES | CC(CN1CCOCC1)NC(=O)/C=C/c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C20H27N3O3/c1-15(14-23-10-12-26-13-11-23)21-19(24)9-4-16-2-5-17(6-3-16)20(25)22-18-7-8-18/h2-6,9,15,18H,7-8,10-14H2,1H3,(H,21,24)(H,22,25)/b9-4+ |
| InChIKey | RJSYQTSIVQMUTK-RUDMXATFSA-N |
| XLogP | 1.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|