C20H15F2N3O3 — CID 55777999
(3-carbamoylphenyl) 1-(3,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate (PubChem CID 55777999) has the molecular formula C20H15F2N3O3 and a molecular weight of 383.35 g/mol. Its IUPAC name is (3-carbamoylphenyl) 1-(3,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate.
| Compound Name | (3-carbamoylphenyl) 1-(3,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55777999 |
| Molecular Formula | C20H15F2N3O3 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (3-carbamoylphenyl) 1-(3,4-difluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
| SMILES | NC(=O)c1cccc(OC(=O)c2nn(-c3ccc(F)c(F)c3)c3c2CCC3)c1 |
| InChI | InChI=1S/C20H15F2N3O3/c21-15-8-7-12(10-16(15)22)25-17-6-2-5-14(17)18(24-25)20(27)28-13-4-1-3-11(9-13)19(23)26/h1,3-4,7-10H,2,5-6H2,(H2,23,26) |
| InChIKey | RTOUCMZKLPPKSQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|