C17H27NO3S2 — CID 55778009
3-cyclopentylsulfonyl-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)propanamide (PubChem CID 55778009) has the molecular formula C17H27NO3S2 and a molecular weight of 357.54 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)propanamide |
|---|---|
| PubChem CID | 55778009 |
| Molecular Formula | C17H27NO3S2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-(2,2-dimethyl-1-thiophen-2-ylpropyl)propanamide |
| SMILES | CC(C)(C)C(NC(=O)CCS(=O)(=O)C1CCCC1)c1cccs1 |
| InChI | InChI=1S/C17H27NO3S2/c1-17(2,3)16(14-9-6-11-22-14)18-15(19)10-12-23(20,21)13-7-4-5-8-13/h6,9,11,13,16H,4-5,7-8,10,12H2,1-3H3,(H,18,19) |
| InChIKey | NQJKAXUEIGQWMG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |