C17H10ClN3O2S — CID 55780190
1-chloro-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]isoquinoline-3-carboxamide (PubChem CID 55780190) has the molecular formula C17H10ClN3O2S and a molecular weight of 355.81 g/mol. Its IUPAC name is 1-chloro-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]isoquinoline-3-carboxamide.
| Compound Name | 1-chloro-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 55780190 |
| Molecular Formula | C17H10ClN3O2S |
| Molecular Weight | 355.81 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 1-chloro-N-[4-(furan-2-yl)-1,3-thiazol-2-yl]isoquinoline-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccco2)cs1)c1cc2ccccc2c(Cl)n1 |
| InChI | InChI=1S/C17H10ClN3O2S/c18-15-11-5-2-1-4-10(11)8-12(19-15)16(22)21-17-20-13(9-24-17)14-6-3-7-23-14/h1-9H,(H,20,21,22) |
| InChIKey | IZUHBWDQFXSYPG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|