C18H13N3O3S — CID 47036926
N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 47036926) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 47036926 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[4-(furan-2-yl)-1,3-thiazol-2-yl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)Nc1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C18H13N3O3S/c1-10-15(11-5-2-3-6-12(11)19-10)16(22)17(23)21-18-20-13(9-25-18)14-7-4-8-24-14/h2-9,19H,1H3,(H,20,21,23) |
| InChIKey | LXHIKLDWAFDXML-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|