C20H28O11 — CID 557805
methyl 3,4,5-triacetyloxy-6-(cyclohexanecarbonyloxy)oxane-2-carboxylate (PubChem CID 557805) has the molecular formula C20H28O11 and a molecular weight of 444.43 g/mol. Its IUPAC name is methyl 3,4,5-triacetyloxy-6-(cyclohexanecarbonyloxy)oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-triacetyloxy-6-(cyclohexanecarbonyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 557805 |
| Molecular Formula | C20H28O11 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | methyl 3,4,5-triacetyloxy-6-(cyclohexanecarbonyloxy)oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(OC(=O)C2CCCCC2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C20H28O11/c1-10(21)27-14-15(28-11(2)22)17(29-12(3)23)20(30-16(14)19(25)26-4)31-18(24)13-8-6-5-7-9-13/h13-17,20H,5-9H2,1-4H3 |
| InChIKey | ZPPNZEAVGCGLHU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|