C19H21N7O4S — CID 55780506
2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[2-methyl-5-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 55780506) has the molecular formula C19H21N7O4S and a molecular weight of 443.49 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[2-methyl-5-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[2-methyl-5-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55780506 |
| Molecular Formula | C19H21N7O4S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[2-methyl-5-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)Nc2cc(-n3cnnn3)ccc2C)cc1 |
| InChI | InChI=1S/C19H21N7O4S/c1-13-4-7-16(26-12-20-23-24-26)10-18(13)22-19(28)11-25(3)31(29,30)17-8-5-15(6-9-17)21-14(2)27/h4-10,12H,11H2,1-3H3,(H,21,27)(H,22,28) |
| InChIKey | OVJOWBJSUHRYHH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |