C20H15BrClN3O4 — CID 55786816
5-bromo-N-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]phenyl]furan-2-carboxamide (PubChem CID 55786816) has the molecular formula C20H15BrClN3O4 and a molecular weight of 476.71 g/mol. Its IUPAC name is 5-bromo-N-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55786816 |
| Molecular Formula | C20H15BrClN3O4 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | 5-bromo-N-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Cc1ccc(NC(=O)c2ccc(Br)o2)cc1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H15BrClN3O4/c21-17-10-9-16(29-17)20(28)23-13-7-5-12(6-8-13)11-18(26)24-25-19(27)14-3-1-2-4-15(14)22/h1-10H,11H2,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | KLECXARTUGBJCD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|