C20H16BrClN2O4 — CID 55945410
5-bromo-N-[2-[4-[(2-chlorophenyl)methoxy]anilino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 55945410) has the molecular formula C20H16BrClN2O4 and a molecular weight of 463.72 g/mol. Its IUPAC name is 5-bromo-N-[2-[4-[(2-chlorophenyl)methoxy]anilino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[4-[(2-chlorophenyl)methoxy]anilino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55945410 |
| Molecular Formula | C20H16BrClN2O4 |
| Molecular Weight | 463.72 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | 5-bromo-N-[2-[4-[(2-chlorophenyl)methoxy]anilino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)o1)Nc1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H16BrClN2O4/c21-18-10-9-17(28-18)20(26)23-11-19(25)24-14-5-7-15(8-6-14)27-12-13-3-1-2-4-16(13)22/h1-10H,11-12H2,(H,23,26)(H,24,25) |
| InChIKey | HNRQIVRCDWCTOB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |