C21H21N5OS2 — CID 55788254
N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]-3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide (PubChem CID 55788254) has the molecular formula C21H21N5OS2 and a molecular weight of 423.57 g/mol. Its IUPAC name is N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]-3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide.
| Compound Name | N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]-3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide |
|---|---|
| PubChem CID | 55788254 |
| Molecular Formula | C21H21N5OS2 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]-3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a]azepine-1-carboxamide |
| SMILES | Cc1nc(NC(=O)c2nc(-c3ccccc3)n3c2CCCCC3)sc1SCC#N |
| InChI | InChI=1S/C21H21N5OS2/c1-14-20(28-13-11-22)29-21(23-14)25-19(27)17-16-10-6-3-7-12-26(16)18(24-17)15-8-4-2-5-9-15/h2,4-5,8-9H,3,6-7,10,12-13H2,1H3,(H,23,25,27) |
| InChIKey | RAPTVPQVKMCHIV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |