C24H22FN3O2 — CID 55789946
N-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 55789946) has the molecular formula C24H22FN3O2 and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 55789946 |
| Molecular Formula | C24H22FN3O2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CNC(=O)Cc3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C24H22FN3O2/c1-2-28-21-9-4-3-8-19(21)20-14-18(10-11-22(20)28)27-24(30)15-26-23(29)13-16-6-5-7-17(25)12-16/h3-12,14H,2,13,15H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | GRDLAGSNNBNILB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |