C23H19F2N3O2 — CID 60550642
N-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]-3,4-difluorobenzamide (PubChem CID 60550642) has the molecular formula C23H19F2N3O2 and a molecular weight of 407.42 g/mol. Its IUPAC name is N-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 60550642 |
| Molecular Formula | C23H19F2N3O2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethyl]-3,4-difluorobenzamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)CNC(=O)c3ccc(F)c(F)c3)ccc21 |
| InChI | InChI=1S/C23H19F2N3O2/c1-2-28-20-6-4-3-5-16(20)17-12-15(8-10-21(17)28)27-22(29)13-26-23(30)14-7-9-18(24)19(25)11-14/h3-12H,2,13H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | HQLDQXYXGTZTFI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |