C22H17BrN4O3 — CID 55792056
N'-[6-(4-bromophenoxy)pyridine-3-carbonyl]-1-methylindole-3-carbohydrazide (PubChem CID 55792056) has the molecular formula C22H17BrN4O3 and a molecular weight of 465.31 g/mol. Its IUPAC name is N'-[6-(4-bromophenoxy)pyridine-3-carbonyl]-1-methylindole-3-carbohydrazide.
| Compound Name | N'-[6-(4-bromophenoxy)pyridine-3-carbonyl]-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 55792056 |
| Molecular Formula | C22H17BrN4O3 |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | N'-[6-(4-bromophenoxy)pyridine-3-carbonyl]-1-methylindole-3-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)c2ccc(Oc3ccc(Br)cc3)nc2)c2ccccc21 |
| InChI | InChI=1S/C22H17BrN4O3/c1-27-13-18(17-4-2-3-5-19(17)27)22(29)26-25-21(28)14-6-11-20(24-12-14)30-16-9-7-15(23)8-10-16/h2-13H,1H3,(H,25,28)(H,26,29) |
| InChIKey | JVFZRLQOFFAYOP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|