C23H25N5O3 — CID 55792843
N-[2-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methylcarbamoylamino]ethyl]furan-2-carboxamide (PubChem CID 55792843) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-[2-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methylcarbamoylamino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methylcarbamoylamino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55792843 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[2-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methylcarbamoylamino]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccco1)NCc1ccc(N2CCc3ccccc3C2)nc1 |
| InChI | InChI=1S/C23H25N5O3/c29-22(20-6-3-13-31-20)24-10-11-25-23(30)27-15-17-7-8-21(26-14-17)28-12-9-18-4-1-2-5-19(18)16-28/h1-8,13-14H,9-12,15-16H2,(H,24,29)(H2,25,27,30) |
| InChIKey | UZFKCMQUTNNVCM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|