C25H26N4O3 — CID 55801454
N-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methyl]-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide (PubChem CID 55801454) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methyl]-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide.
| Compound Name | N-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methyl]-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide |
|---|---|
| PubChem CID | 55801454 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methyl]-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide |
| SMILES | O=C(C=Cc1ccco1)NCCC(=O)NCc1ccc(N2CCc3ccccc3C2)nc1 |
| InChI | InChI=1S/C25H26N4O3/c30-24(10-8-22-6-3-15-32-22)26-13-11-25(31)28-17-19-7-9-23(27-16-19)29-14-12-20-4-1-2-5-21(20)18-29/h1-10,15-16H,11-14,17-18H2,(H,26,30)(H,28,31) |
| InChIKey | MTEYMQVDZMPSJK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|