C23H29N3O3 — CID 87005367
N-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methyl]-3-(oxolan-2-ylmethoxy)propanamide (PubChem CID 87005367) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methyl]-3-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methyl]-3-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 87005367 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[[6-(3,4-dihydro-1H-isoquinolin-2-yl)-3-pyridinyl]methyl]-3-(oxolan-2-ylmethoxy)propanamide |
| SMILES | O=C(CCOCC1CCCO1)NCc1ccc(N2CCc3ccccc3C2)nc1 |
| InChI | InChI=1S/C23H29N3O3/c27-23(10-13-28-17-21-6-3-12-29-21)25-15-18-7-8-22(24-14-18)26-11-9-19-4-1-2-5-20(19)16-26/h1-2,4-5,7-8,14,21H,3,6,9-13,15-17H2,(H,25,27) |
| InChIKey | UGLFIEOARGMBFH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|