C18H29F3N4O4 — CID 55792857
ethyl 7-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamoylamino]heptanoate (PubChem CID 55792857) has the molecular formula C18H29F3N4O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is ethyl 7-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamoylamino]heptanoate.
| Compound Name | ethyl 7-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamoylamino]heptanoate |
|---|---|
| PubChem CID | 55792857 |
| Molecular Formula | C18H29F3N4O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | ethyl 7-[[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]carbamoylamino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC(=O)NCCC(O)(c1nccn1C)C(F)(F)F |
| InChI | InChI=1S/C18H29F3N4O4/c1-3-29-14(26)8-6-4-5-7-10-23-16(27)24-11-9-17(28,18(19,20)21)15-22-12-13-25(15)2/h12-13,28H,3-11H2,1-2H3,(H2,23,24,27) |
| InChIKey | NBDRWPXHRDVDEB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|