C21H23FN6O2 — CID 55793823
3-fluoro-4-methyl-N-[2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methylcarbamoylamino]ethyl]benzamide (PubChem CID 55793823) has the molecular formula C21H23FN6O2 and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methylcarbamoylamino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methylcarbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 55793823 |
| Molecular Formula | C21H23FN6O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methylcarbamoylamino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)NCc2cccc(Cn3cncn3)c2)cc1F |
| InChI | InChI=1S/C21H23FN6O2/c1-15-5-6-18(10-19(15)22)20(29)24-7-8-25-21(30)26-11-16-3-2-4-17(9-16)12-28-14-23-13-27-28/h2-6,9-10,13-14H,7-8,11-12H2,1H3,(H,24,29)(H2,25,26,30) |
| InChIKey | JABWMOSNCWCEOK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|