C18H21FN4O4 — CID 47071758
N-[2-[2-[(3-fluoro-4-methylbenzoyl)amino]ethylcarbamoylamino]ethyl]furan-3-carboxamide (PubChem CID 47071758) has the molecular formula C18H21FN4O4 and a molecular weight of 376.39 g/mol. Its IUPAC name is N-[2-[2-[(3-fluoro-4-methylbenzoyl)amino]ethylcarbamoylamino]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-[2-[(3-fluoro-4-methylbenzoyl)amino]ethylcarbamoylamino]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 47071758 |
| Molecular Formula | C18H21FN4O4 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[2-[2-[(3-fluoro-4-methylbenzoyl)amino]ethylcarbamoylamino]ethyl]furan-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)NCCNC(=O)c2ccoc2)cc1F |
| InChI | InChI=1S/C18H21FN4O4/c1-12-2-3-13(10-15(12)19)16(24)20-5-7-22-18(26)23-8-6-21-17(25)14-4-9-27-11-14/h2-4,9-11H,5-8H2,1H3,(H,20,24)(H,21,25)(H2,22,23,26) |
| InChIKey | AAXSKDYDBRDHLF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|