C27H29N3O6 — CID 55797040
3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]-N-[3-(morpholine-4-carbonyl)phenyl]prop-2-enamide (PubChem CID 55797040) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is 3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]-N-[3-(morpholine-4-carbonyl)phenyl]prop-2-enamide.
| Compound Name | 3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]-N-[3-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55797040 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 3-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxyphenyl]-N-[3-(morpholine-4-carbonyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2cccc(C(=O)N3CCOCC3)c2)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C27H29N3O6/c1-18-23(19(2)36-29-18)17-35-24-9-7-20(15-25(24)33-3)8-10-26(31)28-22-6-4-5-21(16-22)27(32)30-11-13-34-14-12-30/h4-10,15-16H,11-14,17H2,1-3H3,(H,28,31) |
| InChIKey | BOTKKSNRMPDQDZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|