C22H32ClN3O5S — CID 55806225
4-chloro-N-[2-(cyclohexanecarbonylamino)ethyl]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 55806225) has the molecular formula C22H32ClN3O5S and a molecular weight of 486.03 g/mol. Its IUPAC name is 4-chloro-N-[2-(cyclohexanecarbonylamino)ethyl]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-(cyclohexanecarbonylamino)ethyl]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55806225 |
| Molecular Formula | C22H32ClN3O5S |
| Molecular Weight | 486.03 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-chloro-N-[2-(cyclohexanecarbonylamino)ethyl]-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CC1CN(S(=O)(=O)c2cc(C(=O)NCCNC(=O)C3CCCCC3)ccc2Cl)CC(C)O1 |
| InChI | InChI=1S/C22H32ClN3O5S/c1-15-13-26(14-16(2)31-15)32(29,30)20-12-18(8-9-19(20)23)22(28)25-11-10-24-21(27)17-6-4-3-5-7-17/h8-9,12,15-17H,3-7,10-11,13-14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | QCXMRASBXKRWLM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.03 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|