C23H24ClFN4O2 — CID 55806364
2-chloro-N-[3-[(1-cyclohexylbenzimidazol-2-yl)amino]-3-oxopropyl]-4-fluorobenzamide (PubChem CID 55806364) has the molecular formula C23H24ClFN4O2 and a molecular weight of 442.92 g/mol. Its IUPAC name is 2-chloro-N-[3-[(1-cyclohexylbenzimidazol-2-yl)amino]-3-oxopropyl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[3-[(1-cyclohexylbenzimidazol-2-yl)amino]-3-oxopropyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 55806364 |
| Molecular Formula | C23H24ClFN4O2 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-chloro-N-[3-[(1-cyclohexylbenzimidazol-2-yl)amino]-3-oxopropyl]-4-fluorobenzamide |
| SMILES | O=C(CCNC(=O)c1ccc(F)cc1Cl)Nc1nc2ccccc2n1C1CCCCC1 |
| InChI | InChI=1S/C23H24ClFN4O2/c24-18-14-15(25)10-11-17(18)22(31)26-13-12-21(30)28-23-27-19-8-4-5-9-20(19)29(23)16-6-2-1-3-7-16/h4-5,8-11,14,16H,1-3,6-7,12-13H2,(H,26,31)(H,27,28,30) |
| InChIKey | INXDCTMQPGWMHT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |