C20H22ClNO5 — CID 55806733
5-chloro-N-[3-(2-ethoxyethoxymethyl)phenyl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide (PubChem CID 55806733) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is 5-chloro-N-[3-(2-ethoxyethoxymethyl)phenyl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide.
| Compound Name | 5-chloro-N-[3-(2-ethoxyethoxymethyl)phenyl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
|---|---|
| PubChem CID | 55806733 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 5-chloro-N-[3-(2-ethoxyethoxymethyl)phenyl]-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
| SMILES | CCOCCOCc1cccc(NC(=O)c2cc(Cl)c3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C20H22ClNO5/c1-2-24-6-7-25-13-14-4-3-5-16(10-14)22-20(23)15-11-17(21)19-18(12-15)26-8-9-27-19/h3-5,10-12H,2,6-9,13H2,1H3,(H,22,23) |
| InChIKey | NOGIEADTXBMIRG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|