C24H24ClN3O4S — CID 55807376
4-chloro-2-[[4-[methyl(phenyl)sulfamoyl]benzoyl]amino]-N-propan-2-ylbenzamide (PubChem CID 55807376) has the molecular formula C24H24ClN3O4S and a molecular weight of 485.99 g/mol. Its IUPAC name is 4-chloro-2-[[4-[methyl(phenyl)sulfamoyl]benzoyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 4-chloro-2-[[4-[methyl(phenyl)sulfamoyl]benzoyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 55807376 |
| Molecular Formula | C24H24ClN3O4S |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 4-chloro-2-[[4-[methyl(phenyl)sulfamoyl]benzoyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccc(Cl)cc1NC(=O)c1ccc(S(=O)(=O)N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24ClN3O4S/c1-16(2)26-24(30)21-14-11-18(25)15-22(21)27-23(29)17-9-12-20(13-10-17)33(31,32)28(3)19-7-5-4-6-8-19/h4-16H,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | IDDMUHNSDGTBGD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |