C24H24N2O4 — CID 55808091
2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]butanamide (PubChem CID 55808091) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]butanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 55808091 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[1-(3-methyl-1-benzofuran-2-yl)ethyl]butanamide |
| SMILES | Cc1c(C(C)NC(=O)C(C(C)C)N2C(=O)c3ccccc3C2=O)oc2ccccc12 |
| InChI | InChI=1S/C24H24N2O4/c1-13(2)20(26-23(28)17-10-5-6-11-18(17)24(26)29)22(27)25-15(4)21-14(3)16-9-7-8-12-19(16)30-21/h5-13,15,20H,1-4H3,(H,25,27) |
| InChIKey | ZMRNEKASBXJJQF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|