C16H20BrNO3 — CID 55808918
methyl 1-[(3-bromobenzoyl)amino]-4-methylcyclohexane-1-carboxylate (PubChem CID 55808918) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is methyl 1-[(3-bromobenzoyl)amino]-4-methylcyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(3-bromobenzoyl)amino]-4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 55808918 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | methyl 1-[(3-bromobenzoyl)amino]-4-methylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2cccc(Br)c2)CCC(C)CC1 |
| InChI | InChI=1S/C16H20BrNO3/c1-11-6-8-16(9-7-11,15(20)21-2)18-14(19)12-4-3-5-13(17)10-12/h3-5,10-11H,6-9H2,1-2H3,(H,18,19) |
| InChIKey | MDHHRTIREHKKEZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |