C21H25Cl2N3O — CID 55809129
1-[1-(2,4-dichlorophenyl)ethyl]-1-methyl-3-[(4-pyrrolidin-1-ylphenyl)methyl]urea (PubChem CID 55809129) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-1-methyl-3-[(4-pyrrolidin-1-ylphenyl)methyl]urea.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-1-methyl-3-[(4-pyrrolidin-1-ylphenyl)methyl]urea |
|---|---|
| PubChem CID | 55809129 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-1-methyl-3-[(4-pyrrolidin-1-ylphenyl)methyl]urea |
| SMILES | CC(c1ccc(Cl)cc1Cl)N(C)C(=O)NCc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C21H25Cl2N3O/c1-15(19-10-7-17(22)13-20(19)23)25(2)21(27)24-14-16-5-8-18(9-6-16)26-11-3-4-12-26/h5-10,13,15H,3-4,11-12,14H2,1-2H3,(H,24,27) |
| InChIKey | XTRYOAXNJDFATH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|