C19H23N5OS — CID 55810400
N-(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 55810400) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is N-(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | N-(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55810400 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CCC1CCc2nc(NC(=O)c3cc(C)nc4c3c(C)nn4C)sc2C1 |
| InChI | InChI=1S/C19H23N5OS/c1-5-12-6-7-14-15(9-12)26-19(21-14)22-18(25)13-8-10(2)20-17-16(13)11(3)23-24(17)4/h8,12H,5-7,9H2,1-4H3,(H,21,22,25) |
| InChIKey | NFHQFVYFXFSMGR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |