C20H22Cl2N4O3S — CID 55931977
2,4-dichloro-N-[2-[[2-[(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]amino]-2-oxoethyl]benzamide (PubChem CID 55931977) has the molecular formula C20H22Cl2N4O3S and a molecular weight of 469.39 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[[2-[(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[[2-[(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55931977 |
| Molecular Formula | C20H22Cl2N4O3S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2,4-dichloro-N-[2-[[2-[(6-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]amino]-2-oxoethyl]benzamide |
| SMILES | CCC1CCc2nc(NC(=O)CNC(=O)CNC(=O)c3ccc(Cl)cc3Cl)sc2C1 |
| InChI | InChI=1S/C20H22Cl2N4O3S/c1-2-11-3-6-15-16(7-11)30-20(25-15)26-18(28)10-23-17(27)9-24-19(29)13-5-4-12(21)8-14(13)22/h4-5,8,11H,2-3,6-7,9-10H2,1H3,(H,23,27)(H,24,29)(H,25,26,28) |
| InChIKey | LIUHKZUUCJNOCB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |