C27H25FN4O3 — CID 55810863
N-[(4-cyanophenyl)methyl]-N-[(3-fluorophenyl)methyl]-1-(2-nitrophenyl)piperidine-4-carboxamide (PubChem CID 55810863) has the molecular formula C27H25FN4O3 and a molecular weight of 472.52 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-N-[(3-fluorophenyl)methyl]-1-(2-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-N-[(3-fluorophenyl)methyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55810863 |
| Molecular Formula | C27H25FN4O3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-N-[(3-fluorophenyl)methyl]-1-(2-nitrophenyl)piperidine-4-carboxamide |
| SMILES | N#Cc1ccc(CN(Cc2cccc(F)c2)C(=O)C2CCN(c3ccccc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C27H25FN4O3/c28-24-5-3-4-22(16-24)19-31(18-21-10-8-20(17-29)9-11-21)27(33)23-12-14-30(15-13-23)25-6-1-2-7-26(25)32(34)35/h1-11,16,23H,12-15,18-19H2 |
| InChIKey | TWGNDPGSRARNTR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|