C18H15FN2O5S — CID 55811495
2-(4-fluorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide (PubChem CID 55811495) has the molecular formula C18H15FN2O5S and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide |
|---|---|
| PubChem CID | 55811495 |
| Molecular Formula | C18H15FN2O5S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2O5S/c1-10(27(25,26)13-6-3-11(19)4-7-13)16(22)20-12-5-8-14-15(9-12)18(24)21(2)17(14)23/h3-10H,1-2H3,(H,20,22) |
| InChIKey | NGUSRQVRSNIXGD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|