C22H19ClN2O5 — CID 55812079
N-[5-chloro-2-[[2-(4-propanoylphenoxy)acetyl]amino]phenyl]furan-2-carboxamide (PubChem CID 55812079) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is N-[5-chloro-2-[[2-(4-propanoylphenoxy)acetyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-chloro-2-[[2-(4-propanoylphenoxy)acetyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55812079 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[5-chloro-2-[[2-(4-propanoylphenoxy)acetyl]amino]phenyl]furan-2-carboxamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)Nc2ccc(Cl)cc2NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C22H19ClN2O5/c1-2-19(26)14-5-8-16(9-6-14)30-13-21(27)24-17-10-7-15(23)12-18(17)25-22(28)20-4-3-11-29-20/h3-12H,2,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | YDMMEUHAORCDDN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |